C27H29N5O3 — CID 24745586
benzyl 7-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.4]nonane-2-carboxylate (PubChem CID 24745586) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is benzyl 7-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.4]nonane-2-carboxylate.
| Compound Name | benzyl 7-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.4]nonane-2-carboxylate |
|---|---|
| PubChem CID | 24745586 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | benzyl 7-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.4]nonane-2-carboxylate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2CCC3(CCN(C(=O)OCc4ccccc4)C3)C2)nc1 |
| InChI | InChI=1S/C27H29N5O3/c28-22-8-4-5-9-23(22)30-25(33)21-10-11-24(29-16-21)31-14-12-27(18-31)13-15-32(19-27)26(34)35-17-20-6-2-1-3-7-20/h1-11,16H,12-15,17-19,28H2,(H,30,33) |
| InChIKey | MNRXXSXRXDMZNQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|