C25H28N6O2 — CID 89175435
N-(2-aminophenyl)-6-[4-anilino-4-(methylcarbamoyl)piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 89175435) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[4-anilino-4-(methylcarbamoyl)piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[4-anilino-4-(methylcarbamoyl)piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 89175435 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-(2-aminophenyl)-6-[4-anilino-4-(methylcarbamoyl)piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CNC(=O)C1(Nc2ccccc2)CCN(c2ccc(C(=O)Nc3ccccc3N)cn2)CC1 |
| InChI | InChI=1S/C25H28N6O2/c1-27-24(33)25(30-19-7-3-2-4-8-19)13-15-31(16-14-25)22-12-11-18(17-28-22)23(32)29-21-10-6-5-9-20(21)26/h2-12,17,30H,13-16,26H2,1H3,(H,27,33)(H,29,32) |
| InChIKey | OINXJZCMNRVOQV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 112.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|