C27H34N6O2 — CID 143469870
N-(2-aminophenyl)-6-[1-[(2E,6Z)-octa-2,6-dien-4-yl]-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]pyridine-3-carboxamide (PubChem CID 143469870) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[1-[(2E,6Z)-octa-2,6-dien-4-yl]-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[1-[(2E,6Z)-octa-2,6-dien-4-yl]-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143469870 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-(2-aminophenyl)-6-[1-[(2E,6Z)-octa-2,6-dien-4-yl]-2-oxo-1,3,8-triazaspiro[4.5]decan-8-yl]pyridine-3-carboxamide |
| SMILES | C/C=C\CC(/C=C/C)N1C(=O)NCC12CCN(c1ccc(C(=O)Nc3ccccc3N)cn1)CC2 |
| InChI | InChI=1S/C27H34N6O2/c1-3-5-9-21(8-4-2)33-26(35)30-19-27(33)14-16-32(17-15-27)24-13-12-20(18-29-24)25(34)31-23-11-7-6-10-22(23)28/h3-8,10-13,18,21H,9,14-17,19,28H2,1-2H3,(H,30,35)(H,31,34)/b5-3-,8-4+ |
| InChIKey | KVBIJSSFPUBSCA-VOGDQUTBSA-N |
| XLogP | 4.19 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|