C25H33N5O3 — CID 143469921
tert-butyl (5R)-2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 143469921) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is tert-butyl (5R)-2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | tert-butyl (5R)-2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 143469921 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | tert-butyl (5R)-2-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]2(CCN(c3ccc(C(=O)Nc4ccccc4N)cn3)C2)C1 |
| InChI | InChI=1S/C25H33N5O3/c1-24(2,3)33-23(32)30-13-6-11-25(17-30)12-14-29(16-25)21-10-9-18(15-27-21)22(31)28-20-8-5-4-7-19(20)26/h4-5,7-10,15H,6,11-14,16-17,26H2,1-3H3,(H,28,31)/t25-/m1/s1 |
| InChIKey | YDZGSTIMVPPXTD-RUZDIDTESA-N |
| XLogP | 4.14 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|