C17H19N5O — CID 16662939
N-(2-aminophenyl)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridine-3-carboxamide (PubChem CID 16662939) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 16662939 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(2-aminophenyl)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyridine-3-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(N2C[C@@H]3C[C@H]2CN3)nc1 |
| InChI | InChI=1S/C17H19N5O/c18-14-3-1-2-4-15(14)21-17(23)11-5-6-16(20-8-11)22-10-12-7-13(22)9-19-12/h1-6,8,12-13,19H,7,9-10,18H2,(H,21,23)/t12-,13-/m0/s1 |
| InChIKey | WDPBIGFWZKRZAX-STQMWFEESA-N |
| XLogP | 1.47 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|