C20H25N5O4 — CID 123642305
[(3S)-1-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2-(2-methoxyethyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 123642305) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is [(3S)-1-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2-(2-methoxyethyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3S)-1-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2-(2-methoxyethyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 123642305 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | [(3S)-1-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-2-(2-methoxyethyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | COCCC1[C@@H](NC(=O)O)CCN1c1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C20H25N5O4/c1-29-11-9-17-16(24-20(27)28)8-10-25(17)18-7-6-13(12-22-18)19(26)23-15-5-3-2-4-14(15)21/h2-7,12,16-17,24H,8-11,21H2,1H3,(H,23,26)(H,27,28)/t16-,17?/m0/s1 |
| InChIKey | BGHZJUWVPAOORW-BHWOMJMDSA-N |
| XLogP | 2.17 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|