C20H25N5O4 — CID 91454115
[(3R)-pyrrolidin-3-yl] N-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-N-(2-methoxyethyl)carbamate (PubChem CID 91454115) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is [(3R)-pyrrolidin-3-yl] N-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-N-(2-methoxyethyl)carbamate.
| Compound Name | [(3R)-pyrrolidin-3-yl] N-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 91454115 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | [(3R)-pyrrolidin-3-yl] N-[5-[(2-aminophenyl)carbamoyl]-2-pyridinyl]-N-(2-methoxyethyl)carbamate |
| SMILES | COCCN(C(=O)O[C@@H]1CCNC1)c1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C20H25N5O4/c1-28-11-10-25(20(27)29-15-8-9-22-13-15)18-7-6-14(12-23-18)19(26)24-17-5-3-2-4-16(17)21/h2-7,12,15,22H,8-11,13,21H2,1H3,(H,24,26)/t15-/m1/s1 |
| InChIKey | YINCARVSOSYZTA-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|