C18H24N4O — CID 160904181
N-(2-aminophenyl)-4-[[(3S)-pyrrolidin-3-yl]amino]benzamide;methane (PubChem CID 160904181) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[(3S)-pyrrolidin-3-yl]amino]benzamide;methane.
| Compound Name | N-(2-aminophenyl)-4-[[(3S)-pyrrolidin-3-yl]amino]benzamide;methane |
|---|---|
| PubChem CID | 160904181 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(2-aminophenyl)-4-[[(3S)-pyrrolidin-3-yl]amino]benzamide;methane |
| SMILES | C.Nc1ccccc1NC(=O)c1ccc(N[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C17H20N4O.CH4/c18-15-3-1-2-4-16(15)21-17(22)12-5-7-13(8-6-12)20-14-9-10-19-11-14;/h1-8,14,19-20H,9-11,18H2,(H,21,22);1H4/t14-;/m0./s1 |
| InChIKey | SPXFFEFXXHDMMA-UQKRIMTDSA-N |
| XLogP | 2.93 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|