C24H34N4O — CID 157178118
N-(2-aminophenyl)-4-[[1-(cyclopropylmethyl)azepan-4-yl]amino]benzamide;methane (PubChem CID 157178118) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[1-(cyclopropylmethyl)azepan-4-yl]amino]benzamide;methane.
| Compound Name | N-(2-aminophenyl)-4-[[1-(cyclopropylmethyl)azepan-4-yl]amino]benzamide;methane |
|---|---|
| PubChem CID | 157178118 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-(2-aminophenyl)-4-[[1-(cyclopropylmethyl)azepan-4-yl]amino]benzamide;methane |
| SMILES | C.Nc1ccccc1NC(=O)c1ccc(NC2CCCN(CC3CC3)CC2)cc1 |
| InChI | InChI=1S/C23H30N4O.CH4/c24-21-5-1-2-6-22(21)26-23(28)18-9-11-20(12-10-18)25-19-4-3-14-27(15-13-19)16-17-7-8-17;/h1-2,5-6,9-12,17,19,25H,3-4,7-8,13-16,24H2,(H,26,28);1H4 |
| InChIKey | AOGHTULNOYNGHD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|