C24H31Cl2N3O2 — CID 138673093
N-(2-aminophenyl)-4-[[8-(cyclopropylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;dihydrochloride (PubChem CID 138673093) has the molecular formula C24H31Cl2N3O2 and a molecular weight of 464.44 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[8-(cyclopropylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;dihydrochloride.
| Compound Name | N-(2-aminophenyl)-4-[[8-(cyclopropylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 138673093 |
| Molecular Formula | C24H31Cl2N3O2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[8-(cyclopropylmethyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1NC(=O)c1ccc(OC2CC3CCC(C2)N3CC2CC2)cc1 |
| InChI | InChI=1S/C24H29N3O2.2ClH/c25-22-3-1-2-4-23(22)26-24(28)17-7-11-20(12-8-17)29-21-13-18-9-10-19(14-21)27(18)15-16-5-6-16;;/h1-4,7-8,11-12,16,18-19,21H,5-6,9-10,13-15,25H2,(H,26,28);2*1H |
| InChIKey | GWQXQMVXYNWZJO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|