About N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane
N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane (PubChem CID 160587911) has the molecular formula C23H33N3O2
and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane |
| PubChem CID | 160587911 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane |
| SMILES | C.CC(C)CN1CCC(Oc2ccc(C(=O)Nc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O2.CH4/c1-16(2)15-25-13-11-19(12-14-25)27-18-9-7-17(8-10-18)22(26)24-21-6-4-3-5-20(21)23;/h3-10,16,19H,11-15,23H2,1-2H3,(H,24,26);1H4 |
| InChIKey | RCQABSUKSULQJE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane?
The IUPAC name of N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane (CID 160587911) is N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane.
What is the SMILES notation for N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane?
The canonical SMILES for N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane is C.CC(C)CN1CCC(Oc2ccc(C(=O)Nc3ccccc3N)cc2)CC1.
What is the InChIKey of N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane?
The InChIKey is RCQABSUKSULQJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O2.CH4/c1-16(2)15-25-13-11-19(12-14-25)27-18-9-7-17(8-10-18)22(26)24-21-6-4-3-5-20(21)23;/h3-10,16,19H,11-15,23H2,1-2H3,(H,24,26);1H4.
What are the key properties of N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane?
N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane has a molecular weight of 383.54 g/mol, XLogP of 4.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane is sourced from PubChem (CID 160587911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).