C23H33N3O2 — CID 160587911
N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane (PubChem CID 160587911) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane.
| Compound Name | N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane |
|---|---|
| PubChem CID | 160587911 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-(2-methylpropyl)piperidin-4-yl]oxybenzamide;methane |
| SMILES | C.CC(C)CN1CCC(Oc2ccc(C(=O)Nc3ccccc3N)cc2)CC1 |
| InChI | InChI=1S/C22H29N3O2.CH4/c1-16(2)15-25-13-11-19(12-14-25)27-18-9-7-17(8-10-18)22(26)24-21-6-4-3-5-20(21)23;/h3-10,16,19H,11-15,23H2,1-2H3,(H,24,26);1H4 |
| InChIKey | RCQABSUKSULQJE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|