C30H41N3O2 — CID 145225760
N-(2-aminophenyl)-4-[1-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]piperidin-4-yl]oxybenzamide (PubChem CID 145225760) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]piperidin-4-yl]oxybenzamide.
| Compound Name | N-(2-aminophenyl)-4-[1-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 145225760 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-[(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)methyl]piperidin-4-yl]oxybenzamide |
| SMILES | CC1CC2CC(C)CC(CN3CCC(Oc4ccc(C(=O)Nc5ccccc5N)cc4)CC3)(C1)C2 |
| InChI | InChI=1S/C30H41N3O2/c1-21-15-23-16-22(2)18-30(17-21,19-23)20-33-13-11-26(12-14-33)35-25-9-7-24(8-10-25)29(34)32-28-6-4-3-5-27(28)31/h3-10,21-23,26H,11-20,31H2,1-2H3,(H,32,34) |
| InChIKey | LBVHWDRRBXCGQF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|