C25H35N3O2 — CID 158787902
N-(2-aminophenyl)-4-[[8-(2-methylpropyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;methane (PubChem CID 158787902) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[8-(2-methylpropyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;methane.
| Compound Name | N-(2-aminophenyl)-4-[[8-(2-methylpropyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;methane |
|---|---|
| PubChem CID | 158787902 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | N-(2-aminophenyl)-4-[[8-(2-methylpropyl)-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide;methane |
| SMILES | C.CC(C)CN1C2CCC1CC(Oc1ccc(C(=O)Nc3ccccc3N)cc1)C2 |
| InChI | InChI=1S/C24H31N3O2.CH4/c1-16(2)15-27-18-9-10-19(27)14-21(13-18)29-20-11-7-17(8-12-20)24(28)26-23-6-4-3-5-22(23)25;/h3-8,11-12,16,18-19,21H,9-10,13-15,25H2,1-2H3,(H,26,28);1H4 |
| InChIKey | IRXKHTNNRCGDSG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|