C27H36N4O3 — CID 137365308
[2-[[4-[[1-(cyclohexylmethyl)azepan-4-yl]amino]benzoyl]amino]phenyl]carbamic acid (PubChem CID 137365308) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is [2-[[4-[[1-(cyclohexylmethyl)azepan-4-yl]amino]benzoyl]amino]phenyl]carbamic acid.
| Compound Name | [2-[[4-[[1-(cyclohexylmethyl)azepan-4-yl]amino]benzoyl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 137365308 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [2-[[4-[[1-(cyclohexylmethyl)azepan-4-yl]amino]benzoyl]amino]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccccc1NC(=O)c1ccc(NC2CCCN(CC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C27H36N4O3/c32-26(29-24-10-4-5-11-25(24)30-27(33)34)21-12-14-23(15-13-21)28-22-9-6-17-31(18-16-22)19-20-7-2-1-3-8-20/h4-5,10-15,20,22,28,30H,1-3,6-9,16-19H2,(H,29,32)(H,33,34) |
| InChIKey | AFHHUBWWJKSSER-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |