C18H20N4O3 — CID 67430633
pyrrolidin-3-yl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate (PubChem CID 67430633) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is pyrrolidin-3-yl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate.
| Compound Name | pyrrolidin-3-yl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67430633 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | pyrrolidin-3-yl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)OC2CCNC2)cc1 |
| InChI | InChI=1S/C18H20N4O3/c19-15-3-1-2-4-16(15)22-17(23)12-5-7-13(8-6-12)21-18(24)25-14-9-10-20-11-14/h1-8,14,20H,9-11,19H2,(H,21,24)(H,22,23) |
| InChIKey | NEMWRNGIQRVSEI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|