C20H18N4O3 — CID 102467936
pyridin-2-ylmethyl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate (PubChem CID 102467936) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is pyridin-2-ylmethyl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate.
| Compound Name | pyridin-2-ylmethyl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 102467936 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | pyridin-2-ylmethyl N-[4-[(2-aminophenyl)carbamoyl]phenyl]carbamate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(NC(=O)OCc2ccccn2)cc1 |
| InChI | InChI=1S/C20H18N4O3/c21-17-6-1-2-7-18(17)24-19(25)14-8-10-15(11-9-14)23-20(26)27-13-16-5-3-4-12-22-16/h1-12H,13,21H2,(H,23,26)(H,24,25) |
| InChIKey | ZPHFRROTFCIGNR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|