C17H15N3O2S — CID 89183253
pyridin-2-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate (PubChem CID 89183253) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is pyridin-2-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate.
| Compound Name | pyridin-2-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 89183253 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | pyridin-2-ylmethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)OCc1ccccn1 |
| InChI | InChI=1S/C17H15N3O2S/c18-14-7-6-12(16-5-3-9-23-16)10-15(14)20-17(21)22-11-13-4-1-2-8-19-13/h1-10H,11,18H2,(H,20,21) |
| InChIKey | WPYRPKNNPHWRGL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|