C18H19NO4 — CID 101373443
benzyl 4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]benzoate (PubChem CID 101373443) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is benzyl 4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]benzoate.
| Compound Name | benzyl 4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 101373443 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | benzyl 4-[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N2C[C@H](O)[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C18H19NO4/c20-16-10-19(11-17(16)21)15-8-6-14(7-9-15)18(22)23-12-13-4-2-1-3-5-13/h1-9,16-17,20-21H,10-12H2/t16-,17-/m0/s1 |
| InChIKey | MXONMCFPVGTWSZ-IRXDYDNUSA-N |
| XLogP | 1.59 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |