C26H33N3O2 — CID 163267927
benzyl 4-[2-(piperidin-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzoate (PubChem CID 163267927) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is benzyl 4-[2-(piperidin-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzoate.
| Compound Name | benzyl 4-[2-(piperidin-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzoate |
|---|---|
| PubChem CID | 163267927 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | benzyl 4-[2-(piperidin-4-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]benzoate |
| SMILES | O=C(OCc1ccccc1)c1ccc(N2CC3CN(CC4CCNCC4)CC3C2)cc1 |
| InChI | InChI=1S/C26H33N3O2/c30-26(31-19-21-4-2-1-3-5-21)22-6-8-25(9-7-22)29-17-23-15-28(16-24(23)18-29)14-20-10-12-27-13-11-20/h1-9,20,23-24,27H,10-19H2 |
| InChIKey | CWRFSCHOHHWRPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |