benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate

C19H22N2O3 — CID 134413903

IUPACbenzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate
SMILESO=C(OCc1ccccc1)c1ccc(N2CCN[C@H](CO)C2)cc1
InChIInChI=1S/C19H22N2O3/c22-13-17-12-21(11-10-20-17)18-8-6-16(7-9-18)19(23)24-14-15-4-2-1-3-5-15/h1-9,17,20,22H,10-14H2/t17-/m0/s1
InChIKeyISOAOVXJHMWUSC-KRWDZBQOSA-N
MW326.40 g/mol
LogP1.81
Rot. Bonds5

About benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate

benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate (PubChem CID 134413903) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate.

Molecular Properties

Compound Namebenzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate
PubChem CID134413903
Molecular FormulaC19H22N2O3
Molecular Weight326.40 g/mol
Exact Mass326.16
IUPAC Namebenzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate
SMILESO=C(OCc1ccccc1)c1ccc(N2CCN[C@H](CO)C2)cc1
InChIInChI=1S/C19H22N2O3/c22-13-17-12-21(11-10-20-17)18-8-6-16(7-9-18)19(23)24-14-15-4-2-1-3-5-15/h1-9,17,20,22H,10-14H2/t17-/m0/s1
InChIKeyISOAOVXJHMWUSC-KRWDZBQOSA-N
XLogP1.81
TPSA61.80 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.40
LogP ≤ 51.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate?
The IUPAC name of benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate (CID 134413903) is benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate.
What is the SMILES notation for benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate?
The canonical SMILES for benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate is O=C(OCc1ccccc1)c1ccc(N2CCN[C@H](CO)C2)cc1.
What is the InChIKey of benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate?
The InChIKey is ISOAOVXJHMWUSC-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H22N2O3/c22-13-17-12-21(11-10-20-17)18-8-6-16(7-9-18)19(23)24-14-15-4-2-1-3-5-15/h1-9,17,20,22H,10-14H2/t17-/m0/s1.
What are the key properties of benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate?
benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate has a molecular weight of 326.40 g/mol, XLogP of 1.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-[(3S)-3-(hydroxymethyl)piperazin-1-yl]benzoate is sourced from PubChem (CID 134413903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).