C27H27N3O4 — CID 118541813
dibenzyl 3-phenyl-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate (PubChem CID 118541813) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is dibenzyl 3-phenyl-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate.
| Compound Name | dibenzyl 3-phenyl-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 118541813 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | dibenzyl 3-phenyl-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CC(CN(c3ccccc3)C2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c31-26(33-19-21-10-4-1-5-11-21)29-24-16-25(18-28(17-24)23-14-8-3-9-15-23)30(29)27(32)34-20-22-12-6-2-7-13-22/h1-15,24-25H,16-20H2 |
| InChIKey | CTJGQVFGIMGZIE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |