C21H25N3O2 — CID 67144831
4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]benzoic acid (PubChem CID 67144831) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]benzoic acid.
| Compound Name | 4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 67144831 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 4-[6-(4-cyclopentylpiperazin-1-yl)-3-pyridinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(N3CCN(C4CCCC4)CC3)nc2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c25-21(26)17-7-5-16(6-8-17)18-9-10-20(22-15-18)24-13-11-23(12-14-24)19-3-1-2-4-19/h5-10,15,19H,1-4,11-14H2,(H,25,26) |
| InChIKey | HNWZBRBVGCMIEJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |