C11H14N2O3S — CID 134258128
methyl 6-(1-oxo-1,4-thiazinan-4-yl)pyridine-3-carboxylate (PubChem CID 134258128) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is methyl 6-(1-oxo-1,4-thiazinan-4-yl)pyridine-3-carboxylate.
| Compound Name | methyl 6-(1-oxo-1,4-thiazinan-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 134258128 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | methyl 6-(1-oxo-1,4-thiazinan-4-yl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCS(=O)CC2)nc1 |
| InChI | InChI=1S/C11H14N2O3S/c1-16-11(14)9-2-3-10(12-8-9)13-4-6-17(15)7-5-13/h2-3,8H,4-7H2,1H3 |
| InChIKey | CNFPTSKQMOVSIS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |