C22H27N3O4 — CID 54670763
methyl 6-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]piperidin-1-yl]pyridine-3-carboxylate (PubChem CID 54670763) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl 6-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]piperidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]piperidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 54670763 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | methyl 6-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]piperidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N2CCC(Oc3ncccc3C3CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C22H27N3O4/c1-27-22(26)17-4-5-20(24-15-17)25-11-6-18(7-12-25)29-21-19(3-2-10-23-21)16-8-13-28-14-9-16/h2-5,10,15-16,18H,6-9,11-14H2,1H3 |
| InChIKey | AAEGZXRDDOKMSA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |