C14H22N4O — CID 39801992
(3S)-1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-ol (PubChem CID 39801992) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is (3S)-1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-ol.
| Compound Name | (3S)-1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 39801992 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (3S)-1-(1-pyrimidin-2-ylpiperidin-4-yl)piperidin-3-ol |
| SMILES | O[C@H]1CCCN(C2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C14H22N4O/c19-13-3-1-8-18(11-13)12-4-9-17(10-5-12)14-15-6-2-7-16-14/h2,6-7,12-13,19H,1,3-5,8-11H2/t13-/m0/s1 |
| InChIKey | KHKPFVPDZLAANS-ZDUSSCGKSA-N |
| XLogP | 0.90 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |