C16H25ClN4O — CID 123375262
1-[1-(2-chloro-5-ethylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-ol (PubChem CID 123375262) has the molecular formula C16H25ClN4O and a molecular weight of 324.86 g/mol. Its IUPAC name is 1-[1-(2-chloro-5-ethylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-ol.
| Compound Name | 1-[1-(2-chloro-5-ethylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 123375262 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[1-(2-chloro-5-ethylpyrimidin-4-yl)piperidin-4-yl]piperidin-3-ol |
| SMILES | CCc1cnc(Cl)nc1N1CCC(N2CCCC(O)C2)CC1 |
| InChI | InChI=1S/C16H25ClN4O/c1-2-12-10-18-16(17)19-15(12)20-8-5-13(6-9-20)21-7-3-4-14(22)11-21/h10,13-14,22H,2-9,11H2,1H3 |
| InChIKey | URVUSTQLBGSZIE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |