C26H36N6O — CID 42278079
N-cyclopentyl-4-[4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)piperidin-1-yl]benzamide (PubChem CID 42278079) has the molecular formula C26H36N6O and a molecular weight of 448.62 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)piperidin-1-yl]benzamide.
| Compound Name | N-cyclopentyl-4-[4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42278079 |
| Molecular Formula | C26H36N6O |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | N-cyclopentyl-4-[4-(4-pyrimidin-2-yl-1,4-diazepan-1-yl)piperidin-1-yl]benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(N2CCC(N3CCCN(c4ncccn4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H36N6O/c33-25(29-22-5-1-2-6-22)21-7-9-23(10-8-21)31-17-11-24(12-18-31)30-15-4-16-32(20-19-30)26-27-13-3-14-28-26/h3,7-10,13-14,22,24H,1-2,4-6,11-12,15-20H2,(H,29,33) |
| InChIKey | JXHNIZAHQYGENJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |