C12H18N4O2S — CID 115314754
6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-sulfonamide (PubChem CID 115314754) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-sulfonamide.
| Compound Name | 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115314754 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6-(3,9-diazabicyclo[4.2.1]nonan-3-yl)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N2CCC3CCC(C2)N3)nc1 |
| InChI | InChI=1S/C12H18N4O2S/c13-19(17,18)11-3-4-12(14-7-11)16-6-5-9-1-2-10(8-16)15-9/h3-4,7,9-10,15H,1-2,5-6,8H2,(H2,13,17,18) |
| InChIKey | BGCREQPLENANHL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |