C26H32ClFN8O5 — CID 149395949
2-[4-chloro-2-[[4-[4-[(3S)-3-[(dimethylamino)methyl]morpholin-4-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 149395949) has the molecular formula C26H32ClFN8O5 and a molecular weight of 591.04 g/mol. Its IUPAC name is 2-[4-chloro-2-[[4-[4-[(3S)-3-[(dimethylamino)methyl]morpholin-4-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[4-[4-[(3S)-3-[(dimethylamino)methyl]morpholin-4-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 149395949 |
| Molecular Formula | C26H32ClFN8O5 |
| Molecular Weight | 591.04 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-[4-chloro-2-[[4-[4-[(3S)-3-[(dimethylamino)methyl]morpholin-4-yl]-2-methoxy-5-nitroanilino]-1,3,5-triazin-2-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2CCOC[C@@H]2CN(C)C)c([N+](=O)[O-])cc1Nc1ncnc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C26H32ClFN8O5/c1-26(2,37)16-8-18(28)17(27)9-19(16)31-24-29-14-30-25(33-24)32-20-10-22(36(38)39)21(11-23(20)40-5)35-6-7-41-13-15(35)12-34(3)4/h8-11,14-15,37H,6-7,12-13H2,1-5H3,(H2,29,30,31,32,33)/t15-/m0/s1 |
| InChIKey | YOLMDCHCPMFDSF-HNNXBMFYSA-N |
| XLogP | 4.06 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|