C26H30ClFN8O3 — CID 175505568
4-(6-chloro-5-fluoro-3,3-dimethyl-2H-indol-1-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-1,3,5-triazin-2-amine (PubChem CID 175505568) has the molecular formula C26H30ClFN8O3 and a molecular weight of 557.03 g/mol. Its IUPAC name is 4-(6-chloro-5-fluoro-3,3-dimethyl-2H-indol-1-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4-(6-chloro-5-fluoro-3,3-dimethyl-2H-indol-1-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175505568 |
| Molecular Formula | C26H30ClFN8O3 |
| Molecular Weight | 557.03 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | 4-(6-chloro-5-fluoro-3,3-dimethyl-2H-indol-1-yl)-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-1,3,5-triazin-2-amine |
| SMILES | COc1cc(N2CCC(N(C)C)C2)c([N+](=O)[O-])cc1Nc1ncnc(N2CC(C)(C)c3cc(F)c(Cl)cc32)n1 |
| InChI | InChI=1S/C26H30ClFN8O3/c1-26(2)13-35(20-9-17(27)18(28)8-16(20)26)25-30-14-29-24(32-25)31-19-10-22(36(37)38)21(11-23(19)39-5)34-7-6-15(12-34)33(3)4/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,29,30,31,32) |
| InChIKey | HTQKHKNSEJHEMB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.03 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|