C20H19ClFN7O3 — CID 171407889
4-(5-chloro-3,3,6-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-1,3,5-triazin-2-amine (PubChem CID 171407889) has the molecular formula C20H19ClFN7O3 and a molecular weight of 459.87 g/mol. Its IUPAC name is 4-(5-chloro-3,3,6-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-(5-chloro-3,3,6-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 171407889 |
| Molecular Formula | C20H19ClFN7O3 |
| Molecular Weight | 459.87 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-(5-chloro-3,3,6-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncnc(N2CC(C)(C)c3nc(Cl)c(C)cc32)n1 |
| InChI | InChI=1S/C20H19ClFN7O3/c1-10-5-14-16(26-17(10)21)20(2,3)8-28(14)19-24-9-23-18(27-19)25-12-7-13(29(30)31)11(22)6-15(12)32-4/h5-7,9H,8H2,1-4H3,(H,23,24,25,27) |
| InChIKey | YNGVSUHVGZYCQG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.87 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|