C21H19FN6O4 — CID 163918666
N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(5-methoxy-1,6-dimethylindol-3-yl)-1,3,5-triazin-2-amine (PubChem CID 163918666) has the molecular formula C21H19FN6O4 and a molecular weight of 438.42 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(5-methoxy-1,6-dimethylindol-3-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(5-methoxy-1,6-dimethylindol-3-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 163918666 |
| Molecular Formula | C21H19FN6O4 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-(5-methoxy-1,6-dimethylindol-3-yl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc2c(-c3ncnc(Nc4cc([N+](=O)[O-])c(F)cc4OC)n3)cn(C)c2cc1C |
| InChI | InChI=1S/C21H19FN6O4/c1-11-5-16-12(6-18(11)31-3)13(9-27(16)2)20-23-10-24-21(26-20)25-15-8-17(28(29)30)14(22)7-19(15)32-4/h5-10H,1-4H3,(H,23,24,25,26) |
| InChIKey | QYMVWVURASUSNH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|