C26H22F2N6O7S — CID 134518293
5-fluoro-1-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-methylbenzimidazol-2-one;4-methylbenzenesulfonic acid (PubChem CID 134518293) has the molecular formula C26H22F2N6O7S and a molecular weight of 600.56 g/mol. Its IUPAC name is 5-fluoro-1-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-methylbenzimidazol-2-one;4-methylbenzenesulfonic acid.
| Compound Name | 5-fluoro-1-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-methylbenzimidazol-2-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 134518293 |
| Molecular Formula | C26H22F2N6O7S |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | 5-fluoro-1-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-methylbenzimidazol-2-one;4-methylbenzenesulfonic acid |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(-n2c(=O)n(C)c3cc(F)ccc32)n1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H14F2N6O4.C7H8O3S/c1-25-15-7-10(20)3-4-13(15)26(19(25)28)17-5-6-22-18(24-17)23-12-9-14(27(29)30)11(21)8-16(12)31-2;1-6-2-4-7(5-3-6)11(8,9)10/h3-9H,1-2H3,(H,22,23,24);2-5H,1H3,(H,8,9,10) |
| InChIKey | FBJOWKGQEARQHT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 171.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|