C19H16FN5O3 — CID 130412775
4-(2,3-dihydroindol-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)pyrimidin-2-amine (PubChem CID 130412775) has the molecular formula C19H16FN5O3 and a molecular weight of 381.37 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)pyrimidin-2-amine.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 130412775 |
| Molecular Formula | C19H16FN5O3 |
| Molecular Weight | 381.37 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-N-(4-fluoro-2-methoxy-5-nitrophenyl)pyrimidin-2-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C19H16FN5O3/c1-28-17-10-13(20)16(25(26)27)11-14(17)22-19-21-8-6-18(23-19)24-9-7-12-4-2-3-5-15(12)24/h2-6,8,10-11H,7,9H2,1H3,(H,21,22,23) |
| InChIKey | HSLRGYVMWZTDQY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|