C20H22N6O3S — CID 162691973
1-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-2-yl]-2-methoxy-4-N,4-N-dimethyl-5-nitrobenzene-1,4-diamine (PubChem CID 162691973) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-2-yl]-2-methoxy-4-N,4-N-dimethyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-2-yl]-2-methoxy-4-N,4-N-dimethyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 162691973 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-N-[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidin-2-yl]-2-methoxy-4-N,4-N-dimethyl-5-nitrobenzene-1,4-diamine |
| SMILES | COc1cc(N(C)C)c([N+](=O)[O-])cc1Nc1nccc(N2CCc3sccc3C2)n1 |
| InChI | InChI=1S/C20H22N6O3S/c1-24(2)15-11-17(29-3)14(10-16(15)26(27)28)22-20-21-7-4-19(23-20)25-8-5-18-13(12-25)6-9-30-18/h4,6-7,9-11H,5,8,12H2,1-3H3,(H,21,22,23) |
| InChIKey | MQJQSDRVVVGCJE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|