C21H18FN5O3 — CID 118912969
N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-spiro[2H-indole-3,1'-cyclopropane]-1-ylpyrimidin-2-amine (PubChem CID 118912969) has the molecular formula C21H18FN5O3 and a molecular weight of 407.41 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-spiro[2H-indole-3,1'-cyclopropane]-1-ylpyrimidin-2-amine.
| Compound Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-spiro[2H-indole-3,1'-cyclopropane]-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 118912969 |
| Molecular Formula | C21H18FN5O3 |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-(4-fluoro-2-methoxy-5-nitrophenyl)-4-spiro[2H-indole-3,1'-cyclopropane]-1-ylpyrimidin-2-amine |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1nccc(N2CC3(CC3)c3ccccc32)n1 |
| InChI | InChI=1S/C21H18FN5O3/c1-30-18-10-14(22)17(27(28)29)11-15(18)24-20-23-9-6-19(25-20)26-12-21(7-8-21)13-4-2-3-5-16(13)26/h2-6,9-11H,7-8,12H2,1H3,(H,23,24,25) |
| InChIKey | JNCXFQDKAIWSAJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|