C15H16FN6O3+ — CID 144908804
[(E)-2-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-iminoprop-1-enyl]-methylazanium (PubChem CID 144908804) has the molecular formula C15H16FN6O3+ and a molecular weight of 347.33 g/mol. Its IUPAC name is [(E)-2-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-iminoprop-1-enyl]-methylazanium.
| Compound Name | [(E)-2-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-iminoprop-1-enyl]-methylazanium |
|---|---|
| PubChem CID | 144908804 |
| Molecular Formula | C15H16FN6O3+ |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [(E)-2-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-3-iminoprop-1-enyl]-methylazanium |
| SMILES | [H]/N=C/C(=C\[NH2+]C)c1ccnc(Nc2cc([N+](=O)[O-])c(F)cc2OC)n1 |
| InChI | InChI=1S/C15H15FN6O3/c1-18-8-9(7-17)11-3-4-19-15(20-11)21-12-6-13(22(23)24)10(16)5-14(12)25-2/h3-8,17-18H,1-2H3,(H,19,20,21)/p+1/b9-8+,17-7+ |
| InChIKey | RYWAEHXYAVOZHS-MZYNZGBKSA-O |
| XLogP | 1.46 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|