C21H16FN5O5 — CID 155176381
methyl 3-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-1H-indole-5-carboxylate (PubChem CID 155176381) has the molecular formula C21H16FN5O5 and a molecular weight of 437.39 g/mol. Its IUPAC name is methyl 3-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-1H-indole-5-carboxylate.
| Compound Name | methyl 3-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 155176381 |
| Molecular Formula | C21H16FN5O5 |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | methyl 3-[2-(4-fluoro-2-methoxy-5-nitroanilino)pyrimidin-4-yl]-1H-indole-5-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]cc(-c3ccnc(Nc4cc([N+](=O)[O-])c(F)cc4OC)n3)c2c1 |
| InChI | InChI=1S/C21H16FN5O5/c1-31-19-8-14(22)18(27(29)30)9-17(19)26-21-23-6-5-16(25-21)13-10-24-15-4-3-11(7-12(13)15)20(28)32-2/h3-10,24H,1-2H3,(H,23,25,26) |
| InChIKey | IXIPQWNCTDUERG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|