C21H19FN6O4 — CID 171500458
3-benzyl-7-(4-fluoro-2-methoxy-5-nitroanilino)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 171500458) has the molecular formula C21H19FN6O4 and a molecular weight of 438.42 g/mol. Its IUPAC name is 3-benzyl-7-(4-fluoro-2-methoxy-5-nitroanilino)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 3-benzyl-7-(4-fluoro-2-methoxy-5-nitroanilino)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 171500458 |
| Molecular Formula | C21H19FN6O4 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-benzyl-7-(4-fluoro-2-methoxy-5-nitroanilino)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc2c(n1)N(C)C(=O)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H19FN6O4/c1-26-19-14(12-27(21(26)29)11-13-6-4-3-5-7-13)10-23-20(25-19)24-16-9-17(28(30)31)15(22)8-18(16)32-2/h3-10H,11-12H2,1-2H3,(H,23,24,25) |
| InChIKey | SBAMORJZZJDZNV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|