C21H20ClFN6O3 — CID 166003826
7-(2-aminoanilino)-3-(2-chloro-6-fluoro-3,5-dimethoxyphenyl)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one (PubChem CID 166003826) has the molecular formula C21H20ClFN6O3 and a molecular weight of 458.88 g/mol. Its IUPAC name is 7-(2-aminoanilino)-3-(2-chloro-6-fluoro-3,5-dimethoxyphenyl)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-(2-aminoanilino)-3-(2-chloro-6-fluoro-3,5-dimethoxyphenyl)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 166003826 |
| Molecular Formula | C21H20ClFN6O3 |
| Molecular Weight | 458.88 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 7-(2-aminoanilino)-3-(2-chloro-6-fluoro-3,5-dimethoxyphenyl)-1-methyl-4H-pyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1cc(OC)c(Cl)c(N2Cc3cnc(Nc4ccccc4N)nc3N(C)C2=O)c1F |
| InChI | InChI=1S/C21H20ClFN6O3/c1-28-19-11(9-25-20(27-19)26-13-7-5-4-6-12(13)24)10-29(21(28)30)18-16(22)14(31-2)8-15(32-3)17(18)23/h4-9H,10,24H2,1-3H3,(H,25,26,27) |
| InChIKey | SZQDTGCMOVNMKZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|