C30H26Cl2N6O4 — CID 86269579
N-[2-[[1-benzyl-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide (PubChem CID 86269579) has the molecular formula C30H26Cl2N6O4 and a molecular weight of 605.48 g/mol. Its IUPAC name is N-[2-[[1-benzyl-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[1-benzyl-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 86269579 |
| Molecular Formula | C30H26Cl2N6O4 |
| Molecular Weight | 605.48 g/mol |
| Exact Mass | 604.14 |
| IUPAC Name | N-[2-[[1-benzyl-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1ncc2c(n1)N(Cc1ccccc1)C(=O)N(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C30H26Cl2N6O4/c1-4-24(39)34-20-12-8-9-13-21(20)35-29-33-15-19-17-37(27-25(31)22(41-2)14-23(42-3)26(27)32)30(40)38(28(19)36-29)16-18-10-6-5-7-11-18/h4-15H,1,16-17H2,2-3H3,(H,34,39)(H,33,35,36) |
| InChIKey | VLXFYEDZVHFGOX-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|