C25H24N6O4 — CID 166655002
N-[2-[[1-but-3-enyl-3-(3,5-dihydroxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide (PubChem CID 166655002) has the molecular formula C25H24N6O4 and a molecular weight of 472.51 g/mol. Its IUPAC name is N-[2-[[1-but-3-enyl-3-(3,5-dihydroxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[1-but-3-enyl-3-(3,5-dihydroxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166655002 |
| Molecular Formula | C25H24N6O4 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[2-[[1-but-3-enyl-3-(3,5-dihydroxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CCCN1C(=O)N(c2cc(O)cc(O)c2)Cc2cnc(Nc3ccccc3NC(=O)C=C)nc21 |
| InChI | InChI=1S/C25H24N6O4/c1-3-5-10-30-23-16(15-31(25(30)35)17-11-18(32)13-19(33)12-17)14-26-24(29-23)28-21-9-7-6-8-20(21)27-22(34)4-2/h3-4,6-9,11-14,32-33H,1-2,5,10,15H2,(H,27,34)(H,26,28,29) |
| InChIKey | BAOXVKBHWZWGJC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|