C24H21FN6O5 — CID 175394658
6-fluoro-1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]indole-3-carbaldehyde (PubChem CID 175394658) has the molecular formula C24H21FN6O5 and a molecular weight of 492.47 g/mol. Its IUPAC name is 6-fluoro-1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]indole-3-carbaldehyde.
| Compound Name | 6-fluoro-1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 175394658 |
| Molecular Formula | C24H21FN6O5 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 6-fluoro-1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]indole-3-carbaldehyde |
| SMILES | COc1cc(N2CCOCC2)c([N+](=O)[O-])cc1Nc1nccc(-n2cc(C=O)c3ccc(F)cc32)n1 |
| InChI | InChI=1S/C24H21FN6O5/c1-35-22-12-20(29-6-8-36-9-7-29)21(31(33)34)11-18(22)27-24-26-5-4-23(28-24)30-13-15(14-32)17-3-2-16(25)10-19(17)30/h2-5,10-14H,6-9H2,1H3,(H,26,27,28) |
| InChIKey | RRLBCXIGCOEGTH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|