C20H21N7O5 — CID 151544621
methyl 3-methyl-1-[2-(4-morpholin-4-yl-3-nitroanilino)pyrimidin-4-yl]pyrazole-4-carboxylate (PubChem CID 151544621) has the molecular formula C20H21N7O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is methyl 3-methyl-1-[2-(4-morpholin-4-yl-3-nitroanilino)pyrimidin-4-yl]pyrazole-4-carboxylate.
| Compound Name | methyl 3-methyl-1-[2-(4-morpholin-4-yl-3-nitroanilino)pyrimidin-4-yl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 151544621 |
| Molecular Formula | C20H21N7O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | methyl 3-methyl-1-[2-(4-morpholin-4-yl-3-nitroanilino)pyrimidin-4-yl]pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2ccnc(Nc3ccc(N4CCOCC4)c([N+](=O)[O-])c3)n2)nc1C |
| InChI | InChI=1S/C20H21N7O5/c1-13-15(19(28)31-2)12-26(24-13)18-5-6-21-20(23-18)22-14-3-4-16(17(11-14)27(29)30)25-7-9-32-10-8-25/h3-6,11-12H,7-10H2,1-2H3,(H,21,22,23) |
| InChIKey | PZEMKHKSIBCZKG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|