C25H25N7O5 — CID 147848799
[1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]-4-phenylpyrazol-3-yl]methanol (PubChem CID 147848799) has the molecular formula C25H25N7O5 and a molecular weight of 503.52 g/mol. Its IUPAC name is [1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]-4-phenylpyrazol-3-yl]methanol.
| Compound Name | [1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]-4-phenylpyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 147848799 |
| Molecular Formula | C25H25N7O5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [1-[2-(2-methoxy-4-morpholin-4-yl-5-nitroanilino)pyrimidin-4-yl]-4-phenylpyrazol-3-yl]methanol |
| SMILES | COc1cc(N2CCOCC2)c([N+](=O)[O-])cc1Nc1nccc(-n2cc(-c3ccccc3)c(CO)n2)n1 |
| InChI | InChI=1S/C25H25N7O5/c1-36-23-14-21(30-9-11-37-12-10-30)22(32(34)35)13-19(23)27-25-26-8-7-24(28-25)31-15-18(20(16-33)29-31)17-5-3-2-4-6-17/h2-8,13-15,33H,9-12,16H2,1H3,(H,26,27,28) |
| InChIKey | HUKLAQFDOJVJIC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|