C23H23N7O4 — CID 126667085
4-(1,2-benzoxazol-3-yl)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyrimidin-2-amine (PubChem CID 126667085) has the molecular formula C23H23N7O4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 4-(1,2-benzoxazol-3-yl)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyrimidin-2-amine.
| Compound Name | 4-(1,2-benzoxazol-3-yl)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 126667085 |
| Molecular Formula | C23H23N7O4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 4-(1,2-benzoxazol-3-yl)-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyrimidin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)c([N+](=O)[O-])cc1Nc1nccc(-c2noc3ccccc23)n1 |
| InChI | InChI=1S/C23H23N7O4/c1-28-9-11-29(12-10-28)18-14-21(33-2)17(13-19(18)30(31)32)26-23-24-8-7-16(25-23)22-15-5-3-4-6-20(15)34-27-22/h3-8,13-14H,9-12H2,1-2H3,(H,24,25,26) |
| InChIKey | UVGGPMRNDVVQTE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|