C25H31N9O3 — CID 162728709
N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-amine (PubChem CID 162728709) has the molecular formula C25H31N9O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-amine.
| Compound Name | N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162728709 |
| Molecular Formula | C25H31N9O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3-dimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(N2CC[C@@H](N(C)C)C2)c([N+](=O)[O-])cc1Nc1ncnc(N2CC(C)(C)c3ncccc32)n1 |
| InChI | InChI=1S/C25H31N9O3/c1-25(2)14-33(18-7-6-9-26-22(18)25)24-28-15-27-23(30-24)29-17-11-20(34(35)36)19(12-21(17)37-5)32-10-8-16(13-32)31(3)4/h6-7,9,11-12,15-16H,8,10,13-14H2,1-5H3,(H,27,28,29,30)/t16-/m1/s1 |
| InChIKey | ANFXGTHPPCVUEE-MRXNPFEDSA-N |
| XLogP | 3.50 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|