C26H28F2N8O3 — CID 126667101
N-[2-(difluoromethoxy)-4-[4-(dimethylamino)piperidin-1-yl]-5-nitrophenyl]-4-(1-methylpyrrolo[3,2-b]pyridin-3-yl)pyrimidin-2-amine (PubChem CID 126667101) has the molecular formula C26H28F2N8O3 and a molecular weight of 538.56 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-4-[4-(dimethylamino)piperidin-1-yl]-5-nitrophenyl]-4-(1-methylpyrrolo[3,2-b]pyridin-3-yl)pyrimidin-2-amine.
| Compound Name | N-[2-(difluoromethoxy)-4-[4-(dimethylamino)piperidin-1-yl]-5-nitrophenyl]-4-(1-methylpyrrolo[3,2-b]pyridin-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 126667101 |
| Molecular Formula | C26H28F2N8O3 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | N-[2-(difluoromethoxy)-4-[4-(dimethylamino)piperidin-1-yl]-5-nitrophenyl]-4-(1-methylpyrrolo[3,2-b]pyridin-3-yl)pyrimidin-2-amine |
| SMILES | CN(C)C1CCN(c2cc(OC(F)F)c(Nc3nccc(-c4cn(C)c5cccnc45)n3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H28F2N8O3/c1-33(2)16-7-11-35(12-8-16)21-14-23(39-25(27)28)19(13-22(21)36(37)38)32-26-30-10-6-18(31-26)17-15-34(3)20-5-4-9-29-24(17)20/h4-6,9-10,13-16,25H,7-8,11-12H2,1-3H3,(H,30,31,32) |
| InChIKey | CZNXHZMKVIYSMN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|