C29H37N7O3 — CID 174141024
N-[4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3,5-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyridin-2-amine (PubChem CID 174141024) has the molecular formula C29H37N7O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3,5-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyridin-2-amine.
| Compound Name | N-[4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3,5-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 174141024 |
| Molecular Formula | C29H37N7O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | N-[4-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]-4-(3,3,5-trimethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)pyridin-2-amine |
| SMILES | COc1cc(N2CCCC2CN(C)C)c([N+](=O)[O-])cc1Nc1cc(N2CC(C)(C)c3nc(C)ccc32)ccn1 |
| InChI | InChI=1S/C29H37N7O3/c1-19-9-10-23-28(31-19)29(2,3)18-35(23)20-11-12-30-27(14-20)32-22-15-25(36(37)38)24(16-26(22)39-6)34-13-7-8-21(34)17-33(4)5/h9-12,14-16,21H,7-8,13,17-18H2,1-6H3,(H,30,32) |
| InChIKey | VXVKZNLUCAPUEO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|