C26H27FN8O3S — CID 175194620
4-[3-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-4-yl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyridin-2-amine (PubChem CID 175194620) has the molecular formula C26H27FN8O3S and a molecular weight of 550.62 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-4-yl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyridin-2-amine.
| Compound Name | 4-[3-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-4-yl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 175194620 |
| Molecular Formula | C26H27FN8O3S |
| Molecular Weight | 550.62 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-5-methylsulfanyl-1,2,4-triazol-4-yl]-N-[2-methoxy-4-(4-methylpiperazin-1-yl)-5-nitrophenyl]pyridin-2-amine |
| SMILES | COc1cc(N2CCN(C)CC2)c([N+](=O)[O-])cc1Nc1cc(-n2c(SC)nnc2-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C26H27FN8O3S/c1-32-10-12-33(13-11-32)21-16-23(38-2)20(15-22(21)35(36)37)29-24-14-19(8-9-28-24)34-25(30-31-26(34)39-3)17-4-6-18(27)7-5-17/h4-9,14-16H,10-13H2,1-3H3,(H,28,29) |
| InChIKey | WRHHXJFLDSFKHF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|